| Drug Name | 
                
                     Beta-fructose phosphate 
                 | 
            
                        
                | Synonyms | 
                
                                         
                        Beta-D-Fructose 6-phosphate; SCHEMBL8056; ZINC4096690; 1mto; 6-O-phosphono-beta-D-fructofuranose; AC1L99OC; C05345; CHEBI:16084; CHEMBL604196; DTXSID90889361; F6P; WURCS=2.0/1,1,0/[ha122h-2b_2-5_6*OPO/3O/3=O]/1/; beta-D-Fructofuranose 6-phosphoric acid; beta-D-fructofuranose 6-(dihydrogen phosphate); {[(2R,3S,4S,5R)-3,4,5-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methoxy}phosphonic acid
                        
                     
                                     | 
            
             
             
             
             
             
             
             
             
            
                                    
                | Structure | 
                
                                    
                    
                                 | 
                
                      | 
            
                        
                | 
                    3D MOL
                    
                        
                    
                 | 
                
                    2D MOL
                    
                        
                    
                 | 
            
                                         
                    | #Ro5 Violations (Lipinski): 2 | 
                    Molecular Weight (mw) | 
                    260.14 | 
                    
                        
                        
                     | 
                
                
                    | Logarithm of the Partition Coefficient (xlogp) | 
                    -3.9 | 
                
                
                    | Rotatable Bond Count (rotbonds) | 
                    4 | 
                
                
                    | Hydrogen Bond Donor Count (hbonddonor) | 
                    6 | 
                
                
                    | Hydrogen Bond Acceptor Count (hbondacc) | 
                    9 | 
                
                 
                                                                
                    | Chemical Identifiers | 
                    
                        
                            
                                - Formula
 
                                - C6H13O9P
 
                                                                - IUPAC Name
 
                                [(2R,3S,4S,5R)-3,4,5-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl dihydrogen phosphate  
                                                                 - Canonical SMILES
 
                                - 
                                    
C(C1C(C(C(O1)(CO)O)O)O)OP(=O)(O)O 
                                 
                                                                 - InChI
 
                                - 
                                    
BGWGXPAPYGQALX-ARQDHWQXSA-N 
                                 
                                 
                                                                - InChIKey
 
                                - 
                                    
1S/C6H13O9P/c7-2-6(10)5(9)4(8)3(15-6)1-14-16(11,12)13/h3-5,7-10H,1-2H2,(H2,11,12,13)/t3-,4-,5+,6-/m1/s1 
                                 
                                                             
                            
                         
                     | 
                
                
                
                    | Cross-matching ID | 
                    
                        
                            
                                                                - PubChem CID
 
                                - 440641
                                    
                                        
                                    
                                
 
                                                                  - ChEBI ID
 
                                - 
                                    
                                
 
                                 
                                                                                                                                                                                                 - INTEDE ID
 
                                - DR2073
                                    
                                        
                                    
                                
 
                                                              
                            
                         
                     | 
                
                 
             
                
                     | 
                     | 
                     | 
                     | 
                     | 
                     | 
                     |