| Drug Name | 
                
                     Carbazole-3-carboxamide analog 1 
                 | 
            
                        
                | Synonyms | 
                
                     PMID27215781-Compound-35                  | 
            
             
             
             
             
             
             
             
                        
                | Drug Type | 
                
                     Small molecular drug 
                 | 
            
             
            
                                    
                | Structure | 
                
                                    
                    
                                 | 
                
                      | 
            
                        
                | 
                    3D MOL
                    
                        
                    
                 | 
                
                    2D MOL
                    
                        
                    
                 | 
            
                                       
                    | #Ro5 Violations (Lipinski): 1 | 
                    Molecular Weight (mw) | 
                    378.5 | 
                    
                        
                        
                     | 
                
                
                    | Logarithm of the Partition Coefficient (xlogp) | 
                    5.3 | 
                
                
                    | Rotatable Bond Count (rotbonds) | 
                    6 | 
                
                
                    | Hydrogen Bond Donor Count (hbonddonor) | 
                    0 | 
                
                
                    | Hydrogen Bond Acceptor Count (hbondacc) | 
                    2 | 
                
                 
                                                                
                    | Chemical Identifiers | 
                    
                        
                            
                                - Formula
 
                                - C24H30N2O2
 
                                                                - IUPAC Name
 
                                (7-methoxy-9-pentylcarbazol-3-yl)-piperidin-1-ylmethanone  
                                                                 - Canonical SMILES
 
                                - 
                                    
CCCCCN1C2=C(C=C(C=C2)C(=O)N3CCCCC3)C4=C1C=C(C=C4)OC 
                                 
                                                                 - InChI
 
                                - 
                                    
InChI=1S/C24H30N2O2/c1-3-4-6-15-26-22-12-9-18(24(27)25-13-7-5-8-14-25)16-21(22)20-11-10-19(28-2)17-23(20)26/h9-12,16-17H,3-8,13-15H2,1-2H3 
                                 
                                 
                                                                - InChIKey
 
                                - 
                                    
LHILAHDXYGCIPJ-UHFFFAOYSA-N 
                                 
                                                             
                            
                         
                     | 
                
                
                
                    | Cross-matching ID | 
                    
                        
                            
                                                                - PubChem CID
 
                                - 46871948
                                    
                                        
                                    
                                
 
                                   
                                                                                                                                                                - TTD ID
 
                                - D0GQ8W
                                    
                                        
                                    
                                
 
                                                                                               
                            
                         
                     | 
                
                 
             
                
                     | 
                     | 
                     | 
                     | 
                     | 
                     | 
                     |