| Drug Name |
Quinazolinedione derivative 2
|
| Synonyms |
PMID27841036-Compound-12 |
| Drug Type |
Small molecular drug
|
| Structure |
|
 |
|
3D MOL
|
2D MOL
|
| #Ro5 Violations (Lipinski): 0 |
Molecular Weight (mw) |
460.5 |
|
| Logarithm of the Partition Coefficient (xlogp) |
1.9 |
| Rotatable Bond Count (rotbonds) |
4 |
| Hydrogen Bond Donor Count (hbonddonor) |
1 |
| Hydrogen Bond Acceptor Count (hbondacc) |
7 |
| Chemical Identifiers |
- Formula
- C24H21FN6O3
- IUPAC Name
5-fluoro-1-[[3-(4-pyrimidin-2-ylpiperazine-1-carbonyl)phenyl]methyl]quinazoline-2,4-dione
- Canonical SMILES
-
C1CN(CCN1C2=NC=CC=N2)C(=O)C3=CC=CC(=C3)CN4C5=C(C(=CC=C5)F)C(=O)NC4=O
- InChI
-
InChI=1S/C24H21FN6O3/c25-18-6-2-7-19-20(18)21(32)28-24(34)31(19)15-16-4-1-5-17(14-16)22(33)29-10-12-30(13-11-29)23-26-8-3-9-27-23/h1-9,14H,10-13,15H2,(H,28,32,34)
- InChIKey
-
QUTRGYJIPOIOGH-UHFFFAOYSA-N
|
| Cross-matching ID |
- PubChem CID
- 68388735
- TTD ID
- D0IX2C
|
|
|
|
|
|
|
|