| Drug Name |
Tricyclic benzimidazole derivative 1
|
| Synonyms |
PMID26161698-Compound-21 |
| Drug Type |
Small molecular drug
|
| Structure |
|
 |
|
3D MOL
|
2D MOL
|
| #Ro5 Violations (Lipinski): 0 |
Molecular Weight (mw) |
479.01 |
|
| Logarithm of the Partition Coefficient (xlogp) |
3.6 |
| Rotatable Bond Count (rotbonds) |
1 |
| Hydrogen Bond Donor Count (hbonddonor) |
1 |
| Hydrogen Bond Acceptor Count (hbondacc) |
3 |
| Chemical Identifiers |
- Formula
- C14H15Br3N4
- IUPAC Name
5,6,7-tribromo-2-piperazin-1-yl-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene
- Canonical SMILES
-
C1CC2=C3C(=C(C(=C2Br)Br)Br)N=C(N3C1)N4CCNCC4
- InChI
-
InChI=1S/C14H15Br3N4/c15-9-8-2-1-5-21-13(8)12(11(17)10(9)16)19-14(21)20-6-3-18-4-7-20/h18H,1-7H2
- InChIKey
-
FUOROZXAYONUGD-UHFFFAOYSA-N
|
| Cross-matching ID |
- PubChem CID
- 75201489
- TTD ID
- D0NY7M
|
|
|
|
|
|
|
|