| Drug Name |
US8481586, 5
|
| Synonyms |
CHEMBL573176; SCHEMBL844935; BDBM50299248; US8481586, 5; 1,10-Dihydropyrrolo[2,3-a]carbazole-3-carboxamide |
| Drug Type |
Small molecular drug
|
| Structure |
|
 |
|
3D MOL
|
2D MOL
|
| #Ro5 Violations (Lipinski): 0 |
Molecular Weight (mw) |
249.27 |
|
| Logarithm of the Partition Coefficient (xlogp) |
2.4 |
| Rotatable Bond Count (rotbonds) |
1 |
| Hydrogen Bond Donor Count (hbonddonor) |
3 |
| Hydrogen Bond Acceptor Count (hbondacc) |
1 |
| Chemical Identifiers |
- Formula
- C15H11N3O
- IUPAC Name
1,10-dihydropyrrolo[2,3-a]carbazole-3-carboxamide
- Canonical SMILES
-
C1=CC=C2C(=C1)C3=C(N2)C4=C(C=C3)C(=CN4)C(=O)N
- InChI
-
InChI=1S/C15H11N3O/c16-15(19)11-7-17-13-10(11)6-5-9-8-3-1-2-4-12(8)18-14(9)13/h1-7,17-18H,(H2,16,19)
- InChIKey
-
MXZKCOUOYWSEKW-UHFFFAOYSA-N
|
| Cross-matching ID |
- PubChem CID
- 44479711
- TTD ID
- D0NE0N
|
|
|
|
|
|
|
|