| Drug Name |
MHHFJYABEVJNEG-UHFFFAOYSA-N
|
| Synonyms |
CHEMBL1076743; SCHEMBL3036046; MHHFJYABEVJNEG-UHFFFAOYSA-N; BDBM50313340; 6-(dipropylamino)-N-(2-methyl-4-sulfamoylphenyl)pyrimidine-4-carboxamide; N-[4-(aminosulfonyl)-2-methylphenyl]-6-(dipropylamino)pyrimidine-4-carboxamide
|
| Drug Type |
Small molecular drug
|
| Structure |
|
 |
|
3D MOL
|
2D MOL
|
| #Ro5 Violations (Lipinski): 0 |
Molecular Weight (mw) |
391.5 |
|
| Logarithm of the Partition Coefficient (xlogp) |
2.5 |
| Rotatable Bond Count (rotbonds) |
8 |
| Hydrogen Bond Donor Count (hbonddonor) |
2 |
| Hydrogen Bond Acceptor Count (hbondacc) |
7 |
| Chemical Identifiers |
- Formula
- C18H25N5O3S
- IUPAC Name
6-(dipropylamino)-N-(2-methyl-4-sulfamoylphenyl)pyrimidine-4-carboxamide
- Canonical SMILES
-
CCCN(CCC)C1=NC=NC(=C1)C(=O)NC2=C(C=C(C=C2)S(=O)(=O)N)C
- InChI
-
InChI=1S/C18H25N5O3S/c1-4-8-23(9-5-2)17-11-16(20-12-21-17)18(24)22-15-7-6-14(10-13(15)3)27(19,25)26/h6-7,10-12H,4-5,8-9H2,1-3H3,(H,22,24)(H2,19,25,26)
- InChIKey
-
MHHFJYABEVJNEG-UHFFFAOYSA-N
|
| Cross-matching ID |
- PubChem CID
- 25182905
- TTD ID
- D0I5TH
|
|
|
|
|
|
|
|