| Drug Name |
US8598210, Table XV, 1
|
| Synonyms |
US8722895, 1: {[5-(3-chloro-phenyl)-3-hydroxy-pyridine-2- carbonyl]-amino}-acetic acid methyl ester; SCHEMBL1921387; CHEMBL3646212; LQWXMRRGVHUWEN-UHFFFAOYSA-N; BDBM107695; US8598210, Table XV, 1; {[5-(3-chloro-phenyl)-3-hydroxy-pyridine-2-carbonyl]-amino}-acetic acid methyl ester
|
| Drug Type |
Small molecular drug
|
| Structure |
|
 |
|
3D MOL
|
2D MOL
|
| #Ro5 Violations (Lipinski): 0 |
Molecular Weight (mw) |
320.73 |
|
| Logarithm of the Partition Coefficient (xlogp) |
2.8 |
| Rotatable Bond Count (rotbonds) |
5 |
| Hydrogen Bond Donor Count (hbonddonor) |
2 |
| Hydrogen Bond Acceptor Count (hbondacc) |
5 |
| Chemical Identifiers |
- Formula
- C15H13ClN2O4
- IUPAC Name
methyl 2-[[5-(3-chlorophenyl)-3-hydroxypyridine-2-carbonyl]amino]acetate
- Canonical SMILES
-
COC(=O)CNC(=O)C1=C(C=C(C=N1)C2=CC(=CC=C2)Cl)O
- InChI
-
InChI=1S/C15H13ClN2O4/c1-22-13(20)8-18-15(21)14-12(19)6-10(7-17-14)9-3-2-4-11(16)5-9/h2-7,19H,8H2,1H3,(H,18,21)
- InChIKey
-
LQWXMRRGVHUWEN-UHFFFAOYSA-N
|
| Cross-matching ID |
- PubChem CID
- 24891582
- TTD ID
- D0Q9AF
|
|
|
|
|
|
|
|