| Drug Name |
1,2,4-triazole [4,3-a]quinoxaline derivative 1
|
| Synonyms |
PMID27321640-Compound-33 |
| Drug Type |
Small molecular drug
|
| Structure |
|
 |
|
3D MOL
|
2D MOL
|
| #Ro5 Violations (Lipinski): 0 |
Molecular Weight (mw) |
294.74 |
|
| Logarithm of the Partition Coefficient (xlogp) |
4.2 |
| Rotatable Bond Count (rotbonds) |
1 |
| Hydrogen Bond Donor Count (hbonddonor) |
0 |
| Hydrogen Bond Acceptor Count (hbondacc) |
3 |
| Chemical Identifiers |
- Formula
- C16H11ClN4
- IUPAC Name
1-(2-chlorophenyl)-4-methyl-[1,2,4]triazolo[4,3-a]quinoxaline
- Canonical SMILES
-
CC1=NC2=CC=CC=C2N3C1=NN=C3C4=CC=CC=C4Cl
- InChI
-
InChI=1S/C16H11ClN4/c1-10-15-19-20-16(11-6-2-3-7-12(11)17)21(15)14-9-5-4-8-13(14)18-10/h2-9H,1H3
- InChIKey
-
CTBSIWZADWNGPL-UHFFFAOYSA-N
|
| Cross-matching ID |
- PubChem CID
- 56933838
- TTD ID
- D09BDD
|
|
|
|
|
|
|
|