| Drug Name |
RG7304
|
| Indication |
| Disease Entry |
ICD 11 |
Status |
REF |
| Solid tumour/cancer |
2A00-2F9Z
|
Phase 1 |
[1] |
| ------------------------------------------------------------------------------------ |
|
|
|
|
| Structure |
|
 |
|
3D MOL
|
2D MOL
|
| #Ro5 Violations (Lipinski): 0 |
Molecular Weight (mw) |
228.25 |
|
| Logarithm of the Partition Coefficient (xlogp) |
1.3 |
| Rotatable Bond Count (rotbonds) |
3 |
| Hydrogen Bond Donor Count (hbonddonor) |
1 |
| Hydrogen Bond Acceptor Count (hbondacc) |
4 |
| Chemical Identifiers |
- Formula
- C12H12N4O
- IUPAC Name
4-[[(Z)-benzylideneamino]-methylamino]-1H-pyridazin-6-one
- Canonical SMILES
-
CN(C1=CC(=O)NN=C1)/N=C\\C2=CC=CC=C2
- InChI
-
InChI=1S/C12H12N4O/c1-16(11-7-12(17)15-13-9-11)14-8-10-5-3-2-4-6-10/h2-9H,1H3,(H,15,17)/b14-8-
- InChIKey
-
CTGDOGPKSFBVDA-ZSOIEALJSA-N
|
| Cross-matching ID |
- PubChem CID
- 74890577
- TTD ID
- D06EFW
|
|
|
|
|
|
|
|