| Drug Name | 5-fluoro-N-(pyridin-2-yl)pyridin-2-amine derivative 1 | 
                        
                | Synonyms | PMID26161698-Compound-28 | 
             
             
             
             
             
             
             
                        
                | Drug Type | Small molecular drug | 
             
            
                                    
                | Structure |  |  | 
                        
                | 3D MOL | 2D MOL | 
                                     
                    | #Ro5 Violations (Lipinski): 0 | Molecular Weight (mw) | 434.5 |  | 
                
                    | Logarithm of the Partition Coefficient (xlogp) | 4.6 | 
                
                    | Rotatable Bond Count (rotbonds) | 7 | 
                
                    | Hydrogen Bond Donor Count (hbonddonor) | 2 | 
                
                    | Hydrogen Bond Acceptor Count (hbondacc) | 9 | 
                 
                                                                
                    | Chemical Identifiers | 
                            
                                FormulaC20H20F2N4O3SIUPAC NameN-[5-fluoro-4-(4-fluoro-2-methoxyphenyl)pyridin-2-yl]-6-methoxy-4-[(methylsulfonimidoyl)methyl]pyridin-2-amineCanonical SMILES
                                    COC1=CC(=CC(=N1)NC2=NC=C(C(=C2)C3=C(C=C(C=C3)F)OC)F)CS(=N)(=O)CInChI
                                    InChI=1S/C20H20F2N4O3S/c1-28-17-8-13(21)4-5-14(17)15-9-18(24-10-16(15)22)25-19-6-12(11-30(3,23)27)7-20(26-19)29-2/h4-10,23H,11H2,1-3H3,(H,24,25,26)InChIKey
                                    OOPSDSZASQDBNK-UHFFFAOYSA-N | 
                
                
                    | Cross-matching ID | 
                            
                                                                PubChem CID74767011
                                    
                                        
                                    
                                TTD IDD0V7RP
                                    
                                        
                                    
                                 | 
                 
             
                
                    |  |  |  |  |  |  |  |