| Drug Name | 
                
                     Alrestatin 
                 | 
            
                        
                | Synonyms | 
                
                                         
                        alrestatin; 51411-04-2; Alrestatine; Alrestatin [INN]; Alrestatinum [INN-Latin]; Alrestatine [INN-French]; Alrestatino [INN-Spanish]; UNII-515DHK15LG; Spectrum_001449; Tocris-0485; (1,3-Dioxo-1H,3H-benzo[de]isoquinolin-2-yl)-acetic acid; (1,3-Dioxo-1H-benzo[de]isoquinolin-2(3H)-yl)acetic acid; NSC 299132; BRN 0244370; AY 22284; CHEMBL63055; 515DHK15LG; NSC299132; 1,3-Dioxo-1H-benz(de)isoquinoline-2(3H)-acetic acid; 1H-Benz[de]isoquinoline-2(3H)-aceticacid, 1,3-dioxo-; NCGC00024613-01
                        
                     
                                     | 
            
             
             
             
             
             
             
             
                        
                | Drug Type | 
                
                     Small molecular drug 
                 | 
            
             
            
                                    
                | Structure | 
                
                                    
                    
                                 | 
                
                      | 
            
                        
                | 
                    3D MOL
                    
                        
                    
                 | 
                
                    2D MOL
                    
                        
                    
                 | 
            
                                     
                    | #Ro5 Violations (Lipinski): 0 | 
                    Molecular Weight (mw) | 
                    255.22 | 
                    
                        
                        
                     | 
                
                
                    | Logarithm of the Partition Coefficient (xlogp) | 
                    1.7 | 
                
                
                    | Rotatable Bond Count (rotbonds) | 
                    2 | 
                
                
                    | Hydrogen Bond Donor Count (hbonddonor) | 
                    1 | 
                
                
                    | Hydrogen Bond Acceptor Count (hbondacc) | 
                    4 | 
                
                 
                                                                
                    | Chemical Identifiers | 
                    
                        
                            
                                - Formula
 
                                - C14H9NO4
 
                                                                - IUPAC Name
 
                                2-(1,3-dioxobenzo[de]isoquinolin-2-yl)acetic acid  
                                                                 - Canonical SMILES
 
                                - 
                                    
C1=CC2=C3C(=C1)C(=O)N(C(=O)C3=CC=C2)CC(=O)O 
                                 
                                                                 - InChI
 
                                - 
                                    
InChI=1S/C14H9NO4/c16-11(17)7-15-13(18)9-5-1-3-8-4-2-6-10(12(8)9)14(15)19/h1-6H,7H2,(H,16,17) 
                                 
                                 
                                                                - InChIKey
 
                                - 
                                    
GCUCIFQCGJIRNT-UHFFFAOYSA-N 
                                 
                                                             
                            
                         
                     | 
                
                
                
                    | Cross-matching ID | 
                    
                        
                            
                                                                - PubChem CID
 
                                - 2120
                                    
                                        
                                    
                                
 
                                   
                                                                - CAS Number
 
                                - 
                                    
                                
 
                                                                                                - UNII
 
                                - 
                                    
                                
 
                                                                                                - DrugBank ID
 
                                - 
                                    
                                
 
                                                                                                - TTD ID
 
                                - D03PIB
                                    
                                        
                                    
                                
 
                                                                                               
                            
                         
                     | 
                
                 
             
                
                     | 
                     | 
                     | 
                     | 
                     | 
                     | 
                     |