| Drug Name |
RS-1636
|
| Indication |
| Disease Entry |
ICD 11 |
Status |
REF |
| Discovery agent |
N.A.
|
Investigative |
[1] |
| ------------------------------------------------------------------------------------ |
|
|
|
|
| Structure |
|
 |
|
3D MOL
|
2D MOL
|
| #Ro5 Violations (Lipinski): 0 |
Molecular Weight (mw) |
206.24 |
|
| Logarithm of the Partition Coefficient (xlogp) |
1.8 |
| Rotatable Bond Count (rotbonds) |
3 |
| Hydrogen Bond Donor Count (hbonddonor) |
1 |
| Hydrogen Bond Acceptor Count (hbondacc) |
4 |
| Chemical Identifiers |
- Formula
- C11H14N2O2
- IUPAC Name
2-[(4,7-dimethyl-1,2-benzoxazol-3-yl)oxy]ethanamine
- Canonical SMILES
-
CC1=C2C(=C(C=C1)C)ON=C2OCCN
- InChI
-
InChI=1S/C11H14N2O2/c1-7-3-4-8(2)10-9(7)11(13-15-10)14-6-5-12/h3-4H,5-6,12H2,1-2H3
- InChIKey
-
ZTMODTQBGMQMDL-UHFFFAOYSA-N
|
| Cross-matching ID |
- PubChem CID
- 10220452
- TTD ID
- D0K4GD
|
|
|
|
|
|
|
|