| Drug Name |
PMID27376512-Compound-Table1Example8
|
| Drug Type |
Small molecular drug
|
| Structure |
|
 |
|
3D MOL
|
2D MOL
|
| #Ro5 Violations (Lipinski): 0 |
Molecular Weight (mw) |
435.4 |
|
| Logarithm of the Partition Coefficient (xlogp) |
3.7 |
| Rotatable Bond Count (rotbonds) |
6 |
| Hydrogen Bond Donor Count (hbonddonor) |
4 |
| Hydrogen Bond Acceptor Count (hbondacc) |
7 |
| Chemical Identifiers |
- Formula
- C24H21NO7
- IUPAC Name
1-(3,4-dihydroxyphenyl)-2-[3-(3,4-dihydroxyphenyl)-4,6-dimethoxyindol-1-yl]ethanone
- Canonical SMILES
-
COC1=CC2=C(C(=C1)OC)C(=CN2CC(=O)C3=CC(=C(C=C3)O)O)C4=CC(=C(C=C4)O)O
- InChI
-
InChI=1S/C24H21NO7/c1-31-15-9-17-24(23(10-15)32-2)16(13-3-5-18(26)20(28)7-13)11-25(17)12-22(30)14-4-6-19(27)21(29)8-14/h3-11,26-29H,12H2,1-2H3
- InChIKey
-
VZIMIRNNOGRJFC-UHFFFAOYSA-N
|
| Cross-matching ID |
- PubChem CID
- 75201482
- TTD ID
- D0RT6C
|
|
|
|
|
|
|
|