| Drug Name |
PMID27376512-Compound-Table1Example16
|
| Drug Type |
Small molecular drug
|
| Structure |
|
 |
|
3D MOL
|
2D MOL
|
| #Ro5 Violations (Lipinski): 0 |
Molecular Weight (mw) |
379.4 |
|
| Logarithm of the Partition Coefficient (xlogp) |
4.6 |
| Rotatable Bond Count (rotbonds) |
4 |
| Hydrogen Bond Donor Count (hbonddonor) |
2 |
| Hydrogen Bond Acceptor Count (hbondacc) |
5 |
| Chemical Identifiers |
- Formula
- C22H15F2NO3
- IUPAC Name
2-[4,6-difluoro-3-(4-hydroxyphenyl)indol-1-yl]-1-(4-hydroxyphenyl)ethanone
- Canonical SMILES
-
C1=CC(=CC=C1C2=CN(C3=C2C(=CC(=C3)F)F)CC(=O)C4=CC=C(C=C4)O)O
- InChI
-
InChI=1S/C22H15F2NO3/c23-15-9-19(24)22-18(13-1-5-16(26)6-2-13)11-25(20(22)10-15)12-21(28)14-3-7-17(27)8-4-14/h1-11,26-27H,12H2
- InChIKey
-
ZSLQOKAZOXSRMM-UHFFFAOYSA-N
|
| Cross-matching ID |
- PubChem CID
- 75201537
- TTD ID
- D05DSL
|
|
|
|
|
|
|
|