| Drug Name | 
                
                     SB 203186 
                 | 
            
                        
                | Synonyms | 
                
                                         
                        SB 203186; SB-203186; 2-piperidin-1-ylethyl 1H-indole-3-carboxylate; Tocris-0785; NCGC00015921-01; Lopac-S-0443; Biomol-NT_000150; AC1MN68M; Lopac0_000347; GTPL255; BPBio1_000617; SCHEMBL1041116; CHEMBL1255781; ZINC14457; CHEBI:92477; BDBM85778; YGKPIROTKVQCCU-UHFFFAOYSA-N; CCG-204442; NCGC00024790-03; NCGC00015921-02; NCGC00024790-01; NCGC00024790-02; NCGC00015921-04; NCGC00015921-03; CAS_135938-17-9; (1-piperidinyl)ethyl 1h-indole 3-carboxylate; 2-(1-piperidyl)ethyl 1H-indole-3-carboxylate; 2-(1-Piperidyl)ethyl 1 H-indole-3-carboxy
                        
                     
                                     | 
            
             
             
             
             
             
             
             
                        
                | Drug Type | 
                
                     Small molecular drug 
                 | 
            
             
            
                                    
                | Structure | 
                
                                    
                    
                                 | 
                
                      | 
            
                        
                | 
                    3D MOL
                    
                        
                    
                 | 
                
                    2D MOL
                    
                        
                    
                 | 
            
                                     
                    | #Ro5 Violations (Lipinski): 0 | 
                    Molecular Weight (mw) | 
                    272.34 | 
                    
                        
                        
                     | 
                
                
                    | Logarithm of the Partition Coefficient (xlogp) | 
                    3.6 | 
                
                
                    | Rotatable Bond Count (rotbonds) | 
                    5 | 
                
                
                    | Hydrogen Bond Donor Count (hbonddonor) | 
                    1 | 
                
                
                    | Hydrogen Bond Acceptor Count (hbondacc) | 
                    3 | 
                
                 
                                                                
                    | Chemical Identifiers | 
                    
                        
                            
                                - Formula
 
                                - C16H20N2O2
 
                                                                - IUPAC Name
 
                                2-piperidin-1-ylethyl 1H-indole-3-carboxylate  
                                                                 - Canonical SMILES
 
                                - 
                                    
C1CCN(CC1)CCOC(=O)C2=CNC3=CC=CC=C32 
                                 
                                                                 - InChI
 
                                - 
                                    
InChI=1S/C16H20N2O2/c19-16(20-11-10-18-8-4-1-5-9-18)14-12-17-15-7-3-2-6-13(14)15/h2-3,6-7,12,17H,1,4-5,8-11H2 
                                 
                                 
                                                                - InChIKey
 
                                - 
                                    
YGKPIROTKVQCCU-UHFFFAOYSA-N 
                                 
                                                             
                            
                         
                     | 
                
                
                
                    | Cross-matching ID | 
                    
                        
                            
                                                                - PubChem CID
 
                                - 3272300
                                    
                                        
                                    
                                
 
                                                                  - ChEBI ID
 
                                - 
                                    
                                
 
                                 
                                                                                                                                                                - TTD ID
 
                                - D0E8KS
                                    
                                        
                                    
                                
 
                                                                                               
                            
                         
                     | 
                
                 
             
                
                     | 
                     | 
                     | 
                     | 
                     | 
                     | 
                     |