| Drug Name | Bicyclic heteroaryl amide derivative 1 | 
                        
                | Synonyms | PMID27724045-Compound-23 | 
             
             
             
             
             
             
             
                        
                | Drug Type | Small molecular drug | 
             
            
                                    
                | Structure |  |  | 
                        
                | 3D MOL | 2D MOL | 
                                     
                    | #Ro5 Violations (Lipinski): 0 | Molecular Weight (mw) | 425.5 |  | 
                
                    | Logarithm of the Partition Coefficient (xlogp) | 4.7 | 
                
                    | Rotatable Bond Count (rotbonds) | 5 | 
                
                    | Hydrogen Bond Donor Count (hbonddonor) | 1 | 
                
                    | Hydrogen Bond Acceptor Count (hbondacc) | 4 | 
                 
                                                                
                    | Chemical Identifiers | 
                            
                                FormulaC26H27N5OIUPAC Name4-methyl-N-[(1-pyridin-3-ylcyclohexyl)methyl]-1-pyrimidin-2-ylindole-3-carboxamideCanonical SMILES
                                    CC1=C2C(=CC=C1)N(C=C2C(=O)NCC3(CCCCC3)C4=CN=CC=C4)C5=NC=CC=N5InChI
                                    InChI=1S/C26H27N5O/c1-19-8-5-10-22-23(19)21(17-31(22)25-28-14-7-15-29-25)24(32)30-18-26(11-3-2-4-12-26)20-9-6-13-27-16-20/h5-10,13-17H,2-4,11-12,18H2,1H3,(H,30,32)InChIKey
                                    OIKQYDBRBPIGDB-UHFFFAOYSA-N | 
                
                
                    | Cross-matching ID | 
                            
                                                                PubChem CID25164165
                                    
                                        
                                    
                                TTD IDD0PI1X
                                    
                                        
                                    
                                 | 
                 
             
                
                    |  |  |  |  |  |  |  |