| Drug Name |
Pyrido[1,2,4]triazolo[4,3-a]pyrazine derivative 2
|
| Synonyms |
PMID27321640-Compound-55 |
| Drug Type |
Small molecular drug
|
| Structure |
|
 |
|
3D MOL
|
2D MOL
|
| #Ro5 Violations (Lipinski): 0 |
Molecular Weight (mw) |
295.72 |
|
| Logarithm of the Partition Coefficient (xlogp) |
3.2 |
| Rotatable Bond Count (rotbonds) |
1 |
| Hydrogen Bond Donor Count (hbonddonor) |
0 |
| Hydrogen Bond Acceptor Count (hbondacc) |
4 |
| Chemical Identifiers |
- Formula
- C15H10ClN5
- IUPAC Name
3-(2-chlorophenyl)-7-methyl-2,4,5,8,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene
- Canonical SMILES
-
CC1=NC2=C(C=CN=C2)N3C1=NN=C3C4=CC=CC=C4Cl
- InChI
-
InChI=1S/C15H10ClN5/c1-9-14-19-20-15(10-4-2-3-5-11(10)16)21(14)13-6-7-17-8-12(13)18-9/h2-8H,1H3
- InChIKey
-
NUACZBDSBLGPGS-UHFFFAOYSA-N
|
| Cross-matching ID |
- PubChem CID
- 71295314
- TTD ID
- D0D0QT
|
|
|
|
|
|
|
|