| Drug Name | SKLB-010 | 
                        
                | Synonyms | Thiazolidinediones (inflammation), Sichuan University | 
             
             
             
                        
                | Indication | 
                                                
                            | Disease Entry | ICD 11 | Status | REF |  
                            | Inflammation | 1A00-CA43.1 | Investigative | [1] |  
                            | ------------------------------------------------------------------------------------ |  |  |  |  | 
             
             
             
             
             
             
            
                                    
                | Structure |  |  | 
                        
                | 3D MOL | 2D MOL | 
                                     
                    | #Ro5 Violations (Lipinski): 0 | Molecular Weight (mw) | 235.26 |  | 
                
                    | Logarithm of the Partition Coefficient (xlogp) | 2.2 | 
                
                    | Rotatable Bond Count (rotbonds) | 2 | 
                
                    | Hydrogen Bond Donor Count (hbonddonor) | 1 | 
                
                    | Hydrogen Bond Acceptor Count (hbondacc) | 4 | 
                 
                                                                
                    | Chemical Identifiers | 
                            
                                FormulaC11H9NO3SIUPAC Name(5Z)-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dioneCanonical SMILES
                                    COC1=CC=C(C=C1)/C=C\\2/C(=O)NC(=O)S2InChI
                                    InChI=1S/C11H9NO3S/c1-15-8-4-2-7(3-5-8)6-9-10(13)12-11(14)16-9/h2-6H,1H3,(H,12,13,14)/b9-6-InChIKey
                                    VRUKGUBMRBLJJW-TWGQIWQCSA-N | 
                
                
                    | Cross-matching ID | 
                            
                                                                PubChem CID5373936
                                    
                                        
                                    
                                CAS Number
                                    
                                TTD IDD09OWC
                                    
                                        
                                    
                                 | 
                 
             
                
                    |  |  |  |  |  |  |  |