| Drug Name | Ethylisothiourea | 
                        
                | Synonyms | 
                        etiron; 2-Ethyl-2-thiopseudourea; ethyron; ETHYLISOTHIOUREA; 2-Ethyl-isothiourea; 2986-20-1; Carbamimidothioic acid, ethyl ester; UNII-236P47H4VR; Pseudourea, 2-ethyl-2-thio-; CHEMBL321691; VFIZBHJTOHUOEK-UHFFFAOYSA-N; 236P47H4VR; S-ethyl-thioureum; Ethiron (Salt/Mix); Ethyl imidothiocarbamate; Tocris-0873; ethylsulfanyl-formamidine; AC1L1JOU; Lopac-E-3149; Ethyl imidothiocarbamate #; AC1Q1UA8; WR 539 (Salt/Mix); Lopac0_000491; SCHEMBL160501
                        
                     | 
             
             
             
             
             
             
             
                        
                | Drug Type | Small molecular drug | 
             
            
                                    
                | Structure |  |  | 
                        
                | 3D MOL | 2D MOL | 
                                     
                    | #Ro5 Violations (Lipinski): 0 | Molecular Weight (mw) | 104.18 |  | 
                
                    | Logarithm of the Partition Coefficient (xlogp) | 0.5 | 
                
                    | Rotatable Bond Count (rotbonds) | 2 | 
                
                    | Hydrogen Bond Donor Count (hbonddonor) | 2 | 
                
                    | Hydrogen Bond Acceptor Count (hbondacc) | 2 | 
                 
                                                                
                    | Chemical Identifiers | 
                            
                                FormulaC3H8N2SIUPAC Nameethyl carbamimidothioateCanonical SMILES
                                    CCSC(=N)NInChI
                                    InChI=1S/C3H8N2S/c1-2-6-3(4)5/h2H2,1H3,(H3,4,5)InChIKey
                                    VFIZBHJTOHUOEK-UHFFFAOYSA-N | 
                
                
                    | Cross-matching ID | 
                            
                                                                PubChem CID5139
                                    
                                        
                                    
                                CAS Number
                                    
                                UNII
                                    
                                DrugBank ID
                                    
                                TTD IDD0I7VD
                                    
                                        
                                    
                                 | 
                 
             
                
                    |  |  |  |  |  |  |  |