| Drug Name | 
                
                     Benzothiazepine analog 11 
                 | 
            
                        
                | Synonyms | 
                
                     PMID26924192-Compound-101                  | 
            
             
             
             
             
             
             
             
                        
                | Drug Type | 
                
                     Small molecular drug 
                 | 
            
             
            
                                    
                | Structure | 
                
                                    
                    
                                 | 
                
                      | 
            
                        
                | 
                    3D MOL
                    
                        
                    
                 | 
                
                    2D MOL
                    
                        
                    
                 | 
            
                                     
                    | #Ro5 Violations (Lipinski): 0 | 
                    Molecular Weight (mw) | 
                    486.6 | 
                    
                        
                        
                     | 
                
                
                    | Logarithm of the Partition Coefficient (xlogp) | 
                    1.9 | 
                
                
                    | Rotatable Bond Count (rotbonds) | 
                    4 | 
                
                
                    | Hydrogen Bond Donor Count (hbonddonor) | 
                    0 | 
                
                
                    | Hydrogen Bond Acceptor Count (hbondacc) | 
                    6 | 
                
                 
                                                                
                    | Chemical Identifiers | 
                    
                        
                            
                                - Formula
 
                                - C24H30N4O5S
 
                                                                - IUPAC Name
 
                                cyclobutyl (3S)-4-acetyl-7-[1-(1,1-dioxothian-4-yl)pyrazol-4-yl]-3-methyl-2,3-dihydroquinoxaline-1-carboxylate  
                                                                 - Canonical SMILES
 
                                - 
                                    
C[C@H]1CN(C2=C(N1C(=O)C)C=CC(=C2)C3=CN(N=C3)C4CCS(=O)(=O)CC4)C(=O)OC5CCC5 
                                 
                                                                 - InChI
 
                                - 
                                    
InChI=1S/C24H30N4O5S/c1-16-14-26(24(30)33-21-4-3-5-21)23-12-18(6-7-22(23)28(16)17(2)29)19-13-25-27(15-19)20-8-10-34(31,32)11-9-20/h6-7,12-13,15-16,20-21H,3-5,8-11,14H2,1-2H3/t16-/m0/s1 
                                 
                                 
                                                                - InChIKey
 
                                - 
                                    
OCRGMHCAJOHZLW-INIZCTEOSA-N 
                                 
                                                             
                            
                         
                     | 
                
                
                
                    | Cross-matching ID | 
                    
                        
                            
                                                                - PubChem CID
 
                                - 118080527
                                    
                                        
                                    
                                
 
                                   
                                                                                                                                                                - TTD ID
 
                                - D0S5ID
                                    
                                        
                                    
                                
 
                                                                                               
                            
                         
                     | 
                
                 
             
                
                     | 
                     | 
                     | 
                     | 
                     | 
                     | 
                     |