| Drug Name |
CS-4771
|
| Indication |
| Disease Entry |
ICD 11 |
Status |
REF |
| Sepsis |
1G40-1G41
|
Discontinued in Phase 1 |
[1] |
| ------------------------------------------------------------------------------------ |
|
|
|
|
| Structure |
|
 |
|
3D MOL
|
2D MOL
|
| #Ro5 Violations (Lipinski): 0 |
Molecular Weight (mw) |
161.2 |
|
| Logarithm of the Partition Coefficient (xlogp) |
-0.2 |
| Rotatable Bond Count (rotbonds) |
3 |
| Hydrogen Bond Donor Count (hbonddonor) |
1 |
| Hydrogen Bond Acceptor Count (hbondacc) |
3 |
| Chemical Identifiers |
- Formula
- C7H15NO3
- IUPAC Name
3-hydroxy-4-(trimethylazaniumyl)butanoate
- Canonical SMILES
-
C[N+](C)(C)CC(CC(=O)[O-])O
- InChI
-
InChI=1S/C7H15NO3/c1-8(2,3)5-6(9)4-7(10)11/h6,9H,4-5H2,1-3H3
- InChIKey
-
PHIQHXFUZVPYII-UHFFFAOYSA-N
|
| Cross-matching ID |
- PubChem CID
- 288
- ChEBI ID
-
- CAS Number
-
- TTD ID
- D09LZA
|
|
|
|
|
|
|
|