| Drug Name |
Pyrazolo[1,5-a]pyrimidine derivative 21
|
| Synonyms |
PMID28270010-Compound-Figure19-1 |
| Drug Type |
Small molecular drug
|
| Structure |
|
 |
|
3D MOL
|
2D MOL
|
| #Ro5 Violations (Lipinski): 0 |
Molecular Weight (mw) |
440.5 |
|
| Logarithm of the Partition Coefficient (xlogp) |
4.8 |
| Rotatable Bond Count (rotbonds) |
4 |
| Hydrogen Bond Donor Count (hbonddonor) |
0 |
| Hydrogen Bond Acceptor Count (hbondacc) |
8 |
| Chemical Identifiers |
- Formula
- C22H22F2N6S
- IUPAC Name
2-tert-butyl-5-[5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-1,3,4-thiadiazole
- Canonical SMILES
-
CC(C)(C)C1=NN=C(S1)C2=C3N=C(C=CN3N=C2)N4CCCC4C5=C(C=CC(=C5)F)F
- InChI
-
InChI=1S/C22H22F2N6S/c1-22(2,3)21-28-27-20(31-21)15-12-25-30-10-8-18(26-19(15)30)29-9-4-5-17(29)14-11-13(23)6-7-16(14)24/h6-8,10-12,17H,4-5,9H2,1-3H3
- InChIKey
-
ZSOVHNMIBOQEED-UHFFFAOYSA-N
|
| Cross-matching ID |
- PubChem CID
- 121395260
- TTD ID
- D0D6UF
|
|
|
|
|
|
|
|