| Drug Name |
ANAVEX 1-41
|
| Indication |
| Disease Entry |
ICD 11 |
Status |
REF |
| Alzheimer disease |
8A20
|
Preclinical |
[1] |
| ------------------------------------------------------------------------------------ |
|
|
|
|
| Structure |
|
 |
|
3D MOL
|
2D MOL
|
| #Ro5 Violations (Lipinski): 0 |
Molecular Weight (mw) |
281.4 |
|
| Logarithm of the Partition Coefficient (xlogp) |
3.5 |
| Rotatable Bond Count (rotbonds) |
4 |
| Hydrogen Bond Donor Count (hbonddonor) |
0 |
| Hydrogen Bond Acceptor Count (hbondacc) |
2 |
| Chemical Identifiers |
- Formula
- C19H23NO
- IUPAC Name
1-(5,5-diphenyloxolan-3-yl)-N,N-dimethylmethanamine
- Canonical SMILES
-
CN(C)CC1CC(OC1)(C2=CC=CC=C2)C3=CC=CC=C3
- InChI
-
InChI=1S/C19H23NO/c1-20(2)14-16-13-19(21-15-16,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,16H,13-15H2,1-2H3
- InChIKey
-
AMVCMSPVJGQNFF-UHFFFAOYSA-N
|
| Cross-matching ID |
- PubChem CID
- 10446473
- TTD ID
- D0T0UC
|
|
|
|
|
|
|
|