| Drug Name |
Phenylpropylamine derivative 2
|
| Synonyms |
PMID28051882-Compound-4 |
| Drug Type |
Small molecular drug
|
| Structure |
|
 |
|
3D MOL
|
2D MOL
|
| #Ro5 Violations (Lipinski): 2 |
Molecular Weight (mw) |
348.5 |
|
| Logarithm of the Partition Coefficient (xlogp) |
7.5 |
| Rotatable Bond Count (rotbonds) |
15 |
| Hydrogen Bond Donor Count (hbonddonor) |
1 |
| Hydrogen Bond Acceptor Count (hbondacc) |
3 |
| Chemical Identifiers |
- Formula
- C21H36N2O2
- IUPAC Name
N-[3-(4-nitrophenyl)propyl]dodecan-1-amine
- Canonical SMILES
-
CCCCCCCCCCCCNCCCC1=CC=C(C=C1)[N+](=O)[O-]
- InChI
-
InChI=1S/C21H36N2O2/c1-2-3-4-5-6-7-8-9-10-11-18-22-19-12-13-20-14-16-21(17-15-20)23(24)25/h14-17,22H,2-13,18-19H2,1H3
- InChIKey
-
HPQAMSDOLBKJBM-UHFFFAOYSA-N
|
| Cross-matching ID |
- PubChem CID
- 46196429
- TTD ID
- D0L0CD
|
|
|
|
|
|
|
|