| Drug Name |
1,2,4-triazole derivative 3
|
| Synonyms |
PMID28051882-Compound-2 |
| Drug Type |
Small molecular drug
|
| Structure |
|
 |
|
3D MOL
|
2D MOL
|
| #Ro5 Violations (Lipinski): 0 |
Molecular Weight (mw) |
371.3 |
|
| Logarithm of the Partition Coefficient (xlogp) |
5 |
| Rotatable Bond Count (rotbonds) |
5 |
| Hydrogen Bond Donor Count (hbonddonor) |
0 |
| Hydrogen Bond Acceptor Count (hbondacc) |
4 |
| Chemical Identifiers |
- Formula
- C16H20Cl2N4S
- IUPAC Name
1-[2-[[1-(3,4-dichlorophenyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]piperidine
- Canonical SMILES
-
CC1=NC(=NN1C2=CC(=C(C=C2)Cl)Cl)SCCN3CCCCC3
- InChI
-
InChI=1S/C16H20Cl2N4S/c1-12-19-16(23-10-9-21-7-3-2-4-8-21)20-22(12)13-5-6-14(17)15(18)11-13/h5-6,11H,2-4,7-10H2,1H3
- InChIKey
-
BCOSIWNFJNBROD-UHFFFAOYSA-N
|
| Cross-matching ID |
- PubChem CID
- 24794804
- TTD ID
- D0MD6P
|
|
|
|
|
|
|
|