| Drug Name |
US9388139, 12
|
| Synonyms |
SCHEMBL12493454; CHEMBL3899621; BDBM236643; US9388139, 12 |
| Drug Type |
Small molecular drug
|
| Structure |
|
 |
|
3D MOL
|
2D MOL
|
| #Ro5 Violations (Lipinski): 1 |
Molecular Weight (mw) |
391.3 |
|
| Logarithm of the Partition Coefficient (xlogp) |
5.5 |
| Rotatable Bond Count (rotbonds) |
4 |
| Hydrogen Bond Donor Count (hbonddonor) |
1 |
| Hydrogen Bond Acceptor Count (hbondacc) |
4 |
| Chemical Identifiers |
- Formula
- C20H20Cl2N2O2
- IUPAC Name
4-[5-tert-butyl-3-(2,4-dichlorophenyl)-3,4-dihydropyrazol-2-yl]benzoic acid
- Canonical SMILES
-
CC(C)(C)C1=NN(C(C1)C2=C(C=C(C=C2)Cl)Cl)C3=CC=C(C=C3)C(=O)O
- InChI
-
InChI=1S/C20H20Cl2N2O2/c1-20(2,3)18-11-17(15-9-6-13(21)10-16(15)22)24(23-18)14-7-4-12(5-8-14)19(25)26/h4-10,17H,11H2,1-3H3,(H,25,26)
- InChIKey
-
DIZHQHRVPINGBC-UHFFFAOYSA-N
|
| Cross-matching ID |
- PubChem CID
- 60194756
- TTD ID
- D0SG9Q
|
|
|
|
|
|
|
|