| Drug Name |
PMID30185082-Compound-64
|
| Drug Type |
Small molecular drug
|
| Structure |
|
 |
|
3D MOL
|
2D MOL
|
| #Ro5 Violations (Lipinski): 0 |
Molecular Weight (mw) |
353.4 |
|
| Logarithm of the Partition Coefficient (xlogp) |
3.9 |
| Rotatable Bond Count (rotbonds) |
7 |
| Hydrogen Bond Donor Count (hbonddonor) |
2 |
| Hydrogen Bond Acceptor Count (hbondacc) |
6 |
| Chemical Identifiers |
- Formula
- C19H22F3NO2
- IUPAC Name
2-methoxy-4-[3-[[4-(trifluoromethyl)phenyl]methylamino]butyl]phenol
- Canonical SMILES
-
CC(CCC1=CC(=C(C=C1)O)OC)NCC2=CC=C(C=C2)C(F)(F)F
- InChI
-
InChI=1S/C19H22F3NO2/c1-13(3-4-14-7-10-17(24)18(11-14)25-2)23-12-15-5-8-16(9-6-15)19(20,21)22/h5-11,13,23-24H,3-4,12H2,1-2H3
- InChIKey
-
JWMMMNZRBWMHKZ-UHFFFAOYSA-N
|
| Cross-matching ID |
- PubChem CID
- 66731659
- TTD ID
- D0SG9W
|
|
|
|
|
|
|
|